C12H24N4OS — CID 64806328
6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexan-1-ol (PubChem CID 64806328) has the molecular formula C12H24N4OS and a molecular weight of 272.42 g/mol. Its IUPAC name is 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexan-1-ol.
| Compound Name | 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexan-1-ol |
|---|---|
| PubChem CID | 64806328 |
| Molecular Formula | C12H24N4OS |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexan-1-ol |
| SMILES | CNC(C)(CO)CCCCSc1nnc(C)n1C |
| InChI | InChI=1S/C12H24N4OS/c1-10-14-15-11(16(10)4)18-8-6-5-7-12(2,9-17)13-3/h13,17H,5-9H2,1-4H3 |
| InChIKey | KFVBERDEGVWHBV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|