C12H20F3N3O — CID 64811507
2-methyl-2-(methylamino)-6-[4-(trifluoromethyl)pyrazol-1-yl]hexan-1-ol (PubChem CID 64811507) has the molecular formula C12H20F3N3O and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-6-[4-(trifluoromethyl)pyrazol-1-yl]hexan-1-ol.
| Compound Name | 2-methyl-2-(methylamino)-6-[4-(trifluoromethyl)pyrazol-1-yl]hexan-1-ol |
|---|---|
| PubChem CID | 64811507 |
| Molecular Formula | C12H20F3N3O |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-methyl-2-(methylamino)-6-[4-(trifluoromethyl)pyrazol-1-yl]hexan-1-ol |
| SMILES | CNC(C)(CO)CCCCn1cc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H20F3N3O/c1-11(9-19,16-2)5-3-4-6-18-8-10(7-17-18)12(13,14)15/h7-8,16,19H,3-6,9H2,1-2H3 |
| InChIKey | YZVFZEWNIHTQSG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|