C16H30N2 — CID 158565632
1-(5,5-dimethylhexyl)-4-(2,2-dimethylpropyl)pyrazole (PubChem CID 158565632) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-(5,5-dimethylhexyl)-4-(2,2-dimethylpropyl)pyrazole.
| Compound Name | 1-(5,5-dimethylhexyl)-4-(2,2-dimethylpropyl)pyrazole |
|---|---|
| PubChem CID | 158565632 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 1-(5,5-dimethylhexyl)-4-(2,2-dimethylpropyl)pyrazole |
| SMILES | CC(C)(C)CCCCn1cc(CC(C)(C)C)cn1 |
| InChI | InChI=1S/C16H30N2/c1-15(2,3)9-7-8-10-18-13-14(12-17-18)11-16(4,5)6/h12-13H,7-11H2,1-6H3 |
| InChIKey | RFFSMUQHSSASJQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|