C26H31N5O4S — CID 6481317
(2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-4-(1,3-thiazole-2-carbonyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-(4-propan-2-ylphenyl)pyrrolidine-1-carboxamide (PubChem CID 6481317) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is (2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-4-(1,3-thiazole-2-carbonyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-(4-propan-2-ylphenyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-4-(1,3-thiazole-2-carbonyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-(4-propan-2-ylphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 6481317 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | (2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-4-(1,3-thiazole-2-carbonyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-(4-propan-2-ylphenyl)pyrrolidine-1-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)N2CCC[C@H]2C(=O)N2CC[C@H]3[C@H]2[C@H](C)C(=O)N3C(=O)c2nccs2)cc1 |
| InChI | InChI=1S/C26H31N5O4S/c1-15(2)17-6-8-18(9-7-17)28-26(35)29-12-4-5-20(29)24(33)30-13-10-19-21(30)16(3)23(32)31(19)25(34)22-27-11-14-36-22/h6-9,11,14-16,19-21H,4-5,10,12-13H2,1-3H3,(H,28,35)/t16-,19-,20-,21+/m0/s1 |
| InChIKey | GZRKAFAXHPVMLR-LRGNLBRXSA-N |
| XLogP | 3.55 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|