About 3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol
3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol (PubChem CID 64814919) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol.
Analyze 3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol?
The IUPAC name of 3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol (CID 64814919) is 3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol.
What is the SMILES notation for 3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol?
The canonical SMILES for 3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol is CNC(CCO)c1cc(C)oc1C.
What is the InChIKey of 3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol?
The InChIKey is DOXDUOCZITXBND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-7-6-9(8(2)13-7)10(11-3)4-5-12/h6,10-12H,4-5H2,1-3H3.
What are the key properties of 3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol?
3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol has a molecular weight of 183.25 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylfuran-3-yl)-3-(methylamino)propan-1-ol is sourced from PubChem (CID 64814919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).