C20H19ClN4O3S — CID 6482636
(3S,5S)-3-(4-chlorophenyl)-3-imidazol-1-yl-2-methyl-5-[(4-nitrophenyl)sulfanylmethyl]-1,2-oxazolidine (PubChem CID 6482636) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is (3S,5S)-3-(4-chlorophenyl)-3-imidazol-1-yl-2-methyl-5-[(4-nitrophenyl)sulfanylmethyl]-1,2-oxazolidine.
| Compound Name | (3S,5S)-3-(4-chlorophenyl)-3-imidazol-1-yl-2-methyl-5-[(4-nitrophenyl)sulfanylmethyl]-1,2-oxazolidine |
|---|---|
| PubChem CID | 6482636 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | (3S,5S)-3-(4-chlorophenyl)-3-imidazol-1-yl-2-methyl-5-[(4-nitrophenyl)sulfanylmethyl]-1,2-oxazolidine |
| SMILES | CN1O[C@H](CSc2ccc([N+](=O)[O-])cc2)C[C@]1(c1ccc(Cl)cc1)n1ccnc1 |
| InChI | InChI=1S/C20H19ClN4O3S/c1-23-20(24-11-10-22-14-24,15-2-4-16(21)5-3-15)12-18(28-23)13-29-19-8-6-17(7-9-19)25(26)27/h2-11,14,18H,12-13H2,1H3/t18-,20+/m0/s1 |
| InChIKey | GDQDWVWARFDZAJ-AZUAARDMSA-N |
| XLogP | 4.57 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|