C12H14N4O3S — CID 64829448
4-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 64829448) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is 4-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 64829448 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | CC1(C)C2C(=O)N(Cc3csc(C(=O)NN)n3)C(=O)C21 |
| InChI | InChI=1S/C12H14N4O3S/c1-12(2)6-7(12)11(19)16(10(6)18)3-5-4-20-9(14-5)8(17)15-13/h4,6-7H,3,13H2,1-2H3,(H,15,17) |
| InChIKey | DRKPCCOWEDPCEO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|