C16H25NO — CID 64850915
N-(3-ethoxy-2,2-dimethylcyclobutyl)-3,4-dimethylaniline (PubChem CID 64850915) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-dimethylcyclobutyl)-3,4-dimethylaniline.
| Compound Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-3,4-dimethylaniline |
|---|---|
| PubChem CID | 64850915 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-3,4-dimethylaniline |
| SMILES | CCOC1CC(Nc2ccc(C)c(C)c2)C1(C)C |
| InChI | InChI=1S/C16H25NO/c1-6-18-15-10-14(16(15,4)5)17-13-8-7-11(2)12(3)9-13/h7-9,14-15,17H,6,10H2,1-5H3 |
| InChIKey | GGTYARBVIWIYRL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |