C14H18F3NO — CID 64850764
N-(3-ethoxy-2,2-dimethylcyclobutyl)-3,4,5-trifluoroaniline (PubChem CID 64850764) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-dimethylcyclobutyl)-3,4,5-trifluoroaniline.
| Compound Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-3,4,5-trifluoroaniline |
|---|---|
| PubChem CID | 64850764 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-3,4,5-trifluoroaniline |
| SMILES | CCOC1CC(Nc2cc(F)c(F)c(F)c2)C1(C)C |
| InChI | InChI=1S/C14H18F3NO/c1-4-19-12-7-11(14(12,2)3)18-8-5-9(15)13(17)10(16)6-8/h5-6,11-12,18H,4,7H2,1-3H3 |
| InChIKey | PNYCZKMPBGTBMC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|