C17H27NO3 — CID 64851150
[2-ethoxy-5-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]phenyl]methanol (PubChem CID 64851150) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is [2-ethoxy-5-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]phenyl]methanol.
| Compound Name | [2-ethoxy-5-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 64851150 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | [2-ethoxy-5-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]phenyl]methanol |
| SMILES | CCOc1ccc(NC2CC(OCC)C2(C)C)cc1CO |
| InChI | InChI=1S/C17H27NO3/c1-5-20-14-8-7-13(9-12(14)11-19)18-15-10-16(21-6-2)17(15,3)4/h7-9,15-16,18-19H,5-6,10-11H2,1-4H3 |
| InChIKey | MCTWCCZIEGRTBZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|