C11H21N3O4S — CID 64893740
3-amino-N-(1-methylsulfonylpiperidin-4-yl)oxolane-3-carboxamide (PubChem CID 64893740) has the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. Its IUPAC name is 3-amino-N-(1-methylsulfonylpiperidin-4-yl)oxolane-3-carboxamide.
| Compound Name | 3-amino-N-(1-methylsulfonylpiperidin-4-yl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 64893740 |
| Molecular Formula | C11H21N3O4S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 3-amino-N-(1-methylsulfonylpiperidin-4-yl)oxolane-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)C2(N)CCOC2)CC1 |
| InChI | InChI=1S/C11H21N3O4S/c1-19(16,17)14-5-2-9(3-6-14)13-10(15)11(12)4-7-18-8-11/h9H,2-8,12H2,1H3,(H,13,15) |
| InChIKey | UHUZDPGFDRMCAK-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |