C18H25ClN2O5S2 — CID 37077615
1-(4-chlorophenyl)sulfonyl-N-(1-methylsulfonylpiperidin-4-yl)cyclopentane-1-carboxamide (PubChem CID 37077615) has the molecular formula C18H25ClN2O5S2 and a molecular weight of 448.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-(1-methylsulfonylpiperidin-4-yl)cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-(1-methylsulfonylpiperidin-4-yl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 37077615 |
| Molecular Formula | C18H25ClN2O5S2 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-(1-methylsulfonylpiperidin-4-yl)cyclopentane-1-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)C2(S(=O)(=O)c3ccc(Cl)cc3)CCCC2)CC1 |
| InChI | InChI=1S/C18H25ClN2O5S2/c1-27(23,24)21-12-8-15(9-13-21)20-17(22)18(10-2-3-11-18)28(25,26)16-6-4-14(19)5-7-16/h4-7,15H,2-3,8-13H2,1H3,(H,20,22) |
| InChIKey | HESREHZCVMKEPZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |