C15H30N4O4S — CID 55597433
1-(2-methyl-2-morpholin-4-ylpropyl)-3-(1-methylsulfonylpiperidin-4-yl)urea (PubChem CID 55597433) has the molecular formula C15H30N4O4S and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-(2-methyl-2-morpholin-4-ylpropyl)-3-(1-methylsulfonylpiperidin-4-yl)urea.
| Compound Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-3-(1-methylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 55597433 |
| Molecular Formula | C15H30N4O4S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-3-(1-methylsulfonylpiperidin-4-yl)urea |
| SMILES | CC(C)(CNC(=O)NC1CCN(S(C)(=O)=O)CC1)N1CCOCC1 |
| InChI | InChI=1S/C15H30N4O4S/c1-15(2,18-8-10-23-11-9-18)12-16-14(20)17-13-4-6-19(7-5-13)24(3,21)22/h13H,4-12H2,1-3H3,(H2,16,17,20) |
| InChIKey | SPQNGWACRDEXSU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |