C13H12ClN3O2 — CID 6490407
1-(7-chloro-4-oxo-1H-quinolin-3-yl)-3-prop-2-enylurea (PubChem CID 6490407) has the molecular formula C13H12ClN3O2 and a molecular weight of 277.71 g/mol. Its IUPAC name is 1-(7-chloro-4-oxo-1H-quinolin-3-yl)-3-prop-2-enylurea.
| Compound Name | 1-(7-chloro-4-oxo-1H-quinolin-3-yl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 6490407 |
| Molecular Formula | C13H12ClN3O2 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 1-(7-chloro-4-oxo-1H-quinolin-3-yl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1c[nH]c2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C13H12ClN3O2/c1-2-5-15-13(19)17-11-7-16-10-6-8(14)3-4-9(10)12(11)18/h2-4,6-7H,1,5H2,(H,16,18)(H2,15,17,19) |
| InChIKey | RZKCSOYPPBSZMS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|