C9H15N5O2S — CID 649256
2-(1-ethyltetrazol-5-yl)sulfanyl-1-morpholin-4-ylethanone (PubChem CID 649256) has the molecular formula C9H15N5O2S and a molecular weight of 257.32 g/mol. Its IUPAC name is 2-(1-ethyltetrazol-5-yl)sulfanyl-1-morpholin-4-ylethanone.
| Compound Name | 2-(1-ethyltetrazol-5-yl)sulfanyl-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 649256 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-(1-ethyltetrazol-5-yl)sulfanyl-1-morpholin-4-ylethanone |
| SMILES | CCn1nnnc1SCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C9H15N5O2S/c1-2-14-9(10-11-12-14)17-7-8(15)13-3-5-16-6-4-13/h2-7H2,1H3 |
| InChIKey | IVSLNMXIOZKWCF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |