C18H21NO — CID 64974310
N-phenylmethoxy-1-(1,2,3,4-tetrahydronaphthalen-1-yl)methanamine (PubChem CID 64974310) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is N-phenylmethoxy-1-(1,2,3,4-tetrahydronaphthalen-1-yl)methanamine.
| Compound Name | N-phenylmethoxy-1-(1,2,3,4-tetrahydronaphthalen-1-yl)methanamine |
|---|---|
| PubChem CID | 64974310 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-phenylmethoxy-1-(1,2,3,4-tetrahydronaphthalen-1-yl)methanamine |
| SMILES | c1ccc(CONCC2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H21NO/c1-2-7-15(8-3-1)14-20-19-13-17-11-6-10-16-9-4-5-12-18(16)17/h1-5,7-9,12,17,19H,6,10-11,13-14H2 |
| InChIKey | SMKCCHAKQJLHNQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|