C14H23N3O2S — CID 64983289
2-(2,5-dimethylpiperazin-1-yl)-N,N-dimethylbenzenesulfonamide (PubChem CID 64983289) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-(2,5-dimethylpiperazin-1-yl)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-(2,5-dimethylpiperazin-1-yl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 64983289 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-(2,5-dimethylpiperazin-1-yl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CC1CN(c2ccccc2S(=O)(=O)N(C)C)C(C)CN1 |
| InChI | InChI=1S/C14H23N3O2S/c1-11-10-17(12(2)9-15-11)13-7-5-6-8-14(13)20(18,19)16(3)4/h5-8,11-12,15H,9-10H2,1-4H3 |
| InChIKey | NVTZESYQOCAMLR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |