C12H19NO5S2 — CID 64998335
2,2-dimethyl-3-(4-methylsulfonylphenoxy)propane-1-sulfonamide (PubChem CID 64998335) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2,2-dimethyl-3-(4-methylsulfonylphenoxy)propane-1-sulfonamide.
| Compound Name | 2,2-dimethyl-3-(4-methylsulfonylphenoxy)propane-1-sulfonamide |
|---|---|
| PubChem CID | 64998335 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2,2-dimethyl-3-(4-methylsulfonylphenoxy)propane-1-sulfonamide |
| SMILES | CC(C)(COc1ccc(S(C)(=O)=O)cc1)CS(N)(=O)=O |
| InChI | InChI=1S/C12H19NO5S2/c1-12(2,9-20(13,16)17)8-18-10-4-6-11(7-5-10)19(3,14)15/h4-7H,8-9H2,1-3H3,(H2,13,16,17) |
| InChIKey | GKBPOIZKKKIZSA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |