C8H14BrN3 — CID 65011142
1-[2-(bromomethyl)pentyl]-1,2,4-triazole (PubChem CID 65011142) has the molecular formula C8H14BrN3 and a molecular weight of 232.12 g/mol. Its IUPAC name is 1-[2-(bromomethyl)pentyl]-1,2,4-triazole.
| Compound Name | 1-[2-(bromomethyl)pentyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 65011142 |
| Molecular Formula | C8H14BrN3 |
| Molecular Weight | 232.12 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 1-[2-(bromomethyl)pentyl]-1,2,4-triazole |
| SMILES | CCCC(CBr)Cn1cncn1 |
| InChI | InChI=1S/C8H14BrN3/c1-2-3-8(4-9)5-12-7-10-6-11-12/h6-8H,2-5H2,1H3 |
| InChIKey | KPQCKTLQJZJEOH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.12 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|