C6H11N3S2 — CID 57273121
4-(1,2,4-triazol-1-yl)butane-1,3-dithiol (PubChem CID 57273121) has the molecular formula C6H11N3S2 and a molecular weight of 189.31 g/mol. Its IUPAC name is 4-(1,2,4-triazol-1-yl)butane-1,3-dithiol.
| Compound Name | 4-(1,2,4-triazol-1-yl)butane-1,3-dithiol |
|---|---|
| PubChem CID | 57273121 |
| Molecular Formula | C6H11N3S2 |
| Molecular Weight | 189.31 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 4-(1,2,4-triazol-1-yl)butane-1,3-dithiol |
| SMILES | SCCC(S)Cn1cncn1 |
| InChI | InChI=1S/C6H11N3S2/c10-2-1-6(11)3-9-5-7-4-8-9/h4-6,10-11H,1-3H2 |
| InChIKey | XZBVPNHBFAJLHH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|