C15H25NO3S — CID 65015190
2-[(2-ethylphenoxy)methyl]-3,3-dimethylbutane-1-sulfonamide (PubChem CID 65015190) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-[(2-ethylphenoxy)methyl]-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | 2-[(2-ethylphenoxy)methyl]-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 65015190 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-[(2-ethylphenoxy)methyl]-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CCc1ccccc1OCC(CS(N)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C15H25NO3S/c1-5-12-8-6-7-9-14(12)19-10-13(15(2,3)4)11-20(16,17)18/h6-9,13H,5,10-11H2,1-4H3,(H2,16,17,18) |
| InChIKey | ASTJXSIOTVRKNT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |