C13H20FNO3S — CID 65015281
2-[(3-fluorophenoxy)methyl]-3,3-dimethylbutane-1-sulfonamide (PubChem CID 65015281) has the molecular formula C13H20FNO3S and a molecular weight of 289.37 g/mol. Its IUPAC name is 2-[(3-fluorophenoxy)methyl]-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | 2-[(3-fluorophenoxy)methyl]-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 65015281 |
| Molecular Formula | C13H20FNO3S |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[(3-fluorophenoxy)methyl]-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)C(COc1cccc(F)c1)CS(N)(=O)=O |
| InChI | InChI=1S/C13H20FNO3S/c1-13(2,3)10(9-19(15,16)17)8-18-12-6-4-5-11(14)7-12/h4-7,10H,8-9H2,1-3H3,(H2,15,16,17) |
| InChIKey | XWFKBUHSHHQNJL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |