C15H31ClO3S — CID 65015755
3,3-dimethyl-2-(octan-2-yloxymethyl)butane-1-sulfonyl chloride (PubChem CID 65015755) has the molecular formula C15H31ClO3S and a molecular weight of 326.93 g/mol. Its IUPAC name is 3,3-dimethyl-2-(octan-2-yloxymethyl)butane-1-sulfonyl chloride.
| Compound Name | 3,3-dimethyl-2-(octan-2-yloxymethyl)butane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 65015755 |
| Molecular Formula | C15H31ClO3S |
| Molecular Weight | 326.93 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3,3-dimethyl-2-(octan-2-yloxymethyl)butane-1-sulfonyl chloride |
| SMILES | CCCCCCC(C)OCC(CS(=O)(=O)Cl)C(C)(C)C |
| InChI | InChI=1S/C15H31ClO3S/c1-6-7-8-9-10-13(2)19-11-14(15(3,4)5)12-20(16,17)18/h13-14H,6-12H2,1-5H3 |
| InChIKey | WJSXYAMAXBUDLJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|