C11H25BrN2 — CID 65016819
N'-[2-(bromomethyl)-3-methylbutyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 65016819) has the molecular formula C11H25BrN2 and a molecular weight of 265.24 g/mol. Its IUPAC name is N'-[2-(bromomethyl)-3-methylbutyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[2-(bromomethyl)-3-methylbutyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 65016819 |
| Molecular Formula | C11H25BrN2 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | N'-[2-(bromomethyl)-3-methylbutyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CC(C)C(CBr)CN(C)CCN(C)C |
| InChI | InChI=1S/C11H25BrN2/c1-10(2)11(8-12)9-14(5)7-6-13(3)4/h10-11H,6-9H2,1-5H3 |
| InChIKey | IGIBGSVPJBXDSN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|