C14H22N2O4S2 — CID 6502847
N-butan-2-yl-5-methyl-4-morpholin-4-ylsulfonylthiophene-2-carboxamide (PubChem CID 6502847) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-butan-2-yl-5-methyl-4-morpholin-4-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-butan-2-yl-5-methyl-4-morpholin-4-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 6502847 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-butan-2-yl-5-methyl-4-morpholin-4-ylsulfonylthiophene-2-carboxamide |
| SMILES | CCC(C)NC(=O)c1cc(S(=O)(=O)N2CCOCC2)c(C)s1 |
| InChI | InChI=1S/C14H22N2O4S2/c1-4-10(2)15-14(17)12-9-13(11(3)21-12)22(18,19)16-5-7-20-8-6-16/h9-10H,4-8H2,1-3H3,(H,15,17) |
| InChIKey | YEFXSVSQPYJPED-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |