C17H20N2O5S2 — CID 6503175
ethyl 4-[[4-[ethyl(methyl)sulfamoyl]thiophene-2-carbonyl]amino]benzoate (PubChem CID 6503175) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is ethyl 4-[[4-[ethyl(methyl)sulfamoyl]thiophene-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[4-[ethyl(methyl)sulfamoyl]thiophene-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 6503175 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | ethyl 4-[[4-[ethyl(methyl)sulfamoyl]thiophene-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cc(S(=O)(=O)N(C)CC)cs2)cc1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-4-19(3)26(22,23)14-10-15(25-11-14)16(20)18-13-8-6-12(7-9-13)17(21)24-5-2/h6-11H,4-5H2,1-3H3,(H,18,20) |
| InChIKey | BGPFNADYMHHORB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |