C16H19NO4S2 — CID 6503161
(3,4-dimethylphenyl) 4-[ethyl(methyl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 6503161) has the molecular formula C16H19NO4S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 4-[ethyl(methyl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | (3,4-dimethylphenyl) 4-[ethyl(methyl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 6503161 |
| Molecular Formula | C16H19NO4S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (3,4-dimethylphenyl) 4-[ethyl(methyl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | CCN(C)S(=O)(=O)c1csc(C(=O)Oc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C16H19NO4S2/c1-5-17(4)23(19,20)14-9-15(22-10-14)16(18)21-13-7-6-11(2)12(3)8-13/h6-10H,5H2,1-4H3 |
| InChIKey | ZSBYJFPTJJQUFP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|