C15H22O3S — CID 65050038
2-methylsulfonyl-1-(4-propan-2-ylphenyl)cyclopentan-1-ol (PubChem CID 65050038) has the molecular formula C15H22O3S and a molecular weight of 282.41 g/mol. Its IUPAC name is 2-methylsulfonyl-1-(4-propan-2-ylphenyl)cyclopentan-1-ol.
| Compound Name | 2-methylsulfonyl-1-(4-propan-2-ylphenyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 65050038 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-methylsulfonyl-1-(4-propan-2-ylphenyl)cyclopentan-1-ol |
| SMILES | CC(C)c1ccc(C2(O)CCCC2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H22O3S/c1-11(2)12-6-8-13(9-7-12)15(16)10-4-5-14(15)19(3,17)18/h6-9,11,14,16H,4-5,10H2,1-3H3 |
| InChIKey | DEQKZQACKOYDKO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |