C13H16Cl2FNO2 — CID 65057343
2-[1-(2,4-dichloro-5-fluorophenyl)ethyl-propan-2-ylamino]acetic acid (PubChem CID 65057343) has the molecular formula C13H16Cl2FNO2 and a molecular weight of 308.18 g/mol. Its IUPAC name is 2-[1-(2,4-dichloro-5-fluorophenyl)ethyl-propan-2-ylamino]acetic acid.
| Compound Name | 2-[1-(2,4-dichloro-5-fluorophenyl)ethyl-propan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 65057343 |
| Molecular Formula | C13H16Cl2FNO2 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-[1-(2,4-dichloro-5-fluorophenyl)ethyl-propan-2-ylamino]acetic acid |
| SMILES | CC(C)N(CC(=O)O)C(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2FNO2/c1-7(2)17(6-13(18)19)8(3)9-4-12(16)11(15)5-10(9)14/h4-5,7-8H,6H2,1-3H3,(H,18,19) |
| InChIKey | MAYUSEIOYYSCMF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|