C15H21Cl2NO2 — CID 65058438
4-[1-(2,4-dichlorophenyl)ethyl-propan-2-ylamino]butanoic acid (PubChem CID 65058438) has the molecular formula C15H21Cl2NO2 and a molecular weight of 318.24 g/mol. Its IUPAC name is 4-[1-(2,4-dichlorophenyl)ethyl-propan-2-ylamino]butanoic acid.
| Compound Name | 4-[1-(2,4-dichlorophenyl)ethyl-propan-2-ylamino]butanoic acid |
|---|---|
| PubChem CID | 65058438 |
| Molecular Formula | C15H21Cl2NO2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-[1-(2,4-dichlorophenyl)ethyl-propan-2-ylamino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)C(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2NO2/c1-10(2)18(8-4-5-15(19)20)11(3)13-7-6-12(16)9-14(13)17/h6-7,9-11H,4-5,8H2,1-3H3,(H,19,20) |
| InChIKey | JZZFLYXVMGMXKI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |