C16H22N2O2 — CID 65058425
3-[tert-butyl(1H-indol-3-ylmethyl)amino]propanoic acid (PubChem CID 65058425) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-[tert-butyl(1H-indol-3-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[tert-butyl(1H-indol-3-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 65058425 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-[tert-butyl(1H-indol-3-ylmethyl)amino]propanoic acid |
| SMILES | CC(C)(C)N(CCC(=O)O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H22N2O2/c1-16(2,3)18(9-8-15(19)20)11-12-10-17-14-7-5-4-6-13(12)14/h4-7,10,17H,8-9,11H2,1-3H3,(H,19,20) |
| InChIKey | PWTOKTJERDUDFP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |