C11H23NO2S — CID 65094526
4-tert-butylcycloheptane-1-sulfonamide (PubChem CID 65094526) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is 4-tert-butylcycloheptane-1-sulfonamide.
| Compound Name | 4-tert-butylcycloheptane-1-sulfonamide |
|---|---|
| PubChem CID | 65094526 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 4-tert-butylcycloheptane-1-sulfonamide |
| SMILES | CC(C)(C)C1CCCC(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C11H23NO2S/c1-11(2,3)9-5-4-6-10(8-7-9)15(12,13)14/h9-10H,4-8H2,1-3H3,(H2,12,13,14) |
| InChIKey | PIVXYKZLLYPJRV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |