C24H29NO3 — CID 65121619
9H-fluoren-9-ylmethyl N-[(4-ethyl-1-hydroxycyclohexyl)methyl]carbamate (PubChem CID 65121619) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(4-ethyl-1-hydroxycyclohexyl)methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(4-ethyl-1-hydroxycyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 65121619 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(4-ethyl-1-hydroxycyclohexyl)methyl]carbamate |
| SMILES | CCC1CCC(O)(CNC(=O)OCC2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C24H29NO3/c1-2-17-11-13-24(27,14-12-17)16-25-23(26)28-15-22-20-9-5-3-7-18(20)19-8-4-6-10-21(19)22/h3-10,17,22,27H,2,11-16H2,1H3,(H,25,26) |
| InChIKey | BFQCLCMITRESNH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |