C13H23N3OS — CID 65130103
cyclohexyl-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 65130103) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is cyclohexyl-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | cyclohexyl-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 65130103 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | cyclohexyl-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | CCCSCc1noc(C(N)C2CCCCC2)n1 |
| InChI | InChI=1S/C13H23N3OS/c1-2-8-18-9-11-15-13(17-16-11)12(14)10-6-4-3-5-7-10/h10,12H,2-9,14H2,1H3 |
| InChIKey | MCKFKDXQYXWPPL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|