C14H25N3S — CID 65132138
4-[3-propan-2-ylsulfanyl-2-(propylamino)propyl]pyridin-2-amine (PubChem CID 65132138) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is 4-[3-propan-2-ylsulfanyl-2-(propylamino)propyl]pyridin-2-amine.
| Compound Name | 4-[3-propan-2-ylsulfanyl-2-(propylamino)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 65132138 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 4-[3-propan-2-ylsulfanyl-2-(propylamino)propyl]pyridin-2-amine |
| SMILES | CCCNC(CSC(C)C)Cc1ccnc(N)c1 |
| InChI | InChI=1S/C14H25N3S/c1-4-6-16-13(10-18-11(2)3)8-12-5-7-17-14(15)9-12/h5,7,9,11,13,16H,4,6,8,10H2,1-3H3,(H2,15,17) |
| InChIKey | FATKKIOMUNUMCI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |