About 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine
1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine (PubChem CID 65132245) has the molecular formula C12H24F3NS
and a molecular weight of 271.39 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine.
Molecular Properties
| Compound Name | 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine |
| PubChem CID | 65132245 |
| Molecular Formula | C12H24F3NS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine |
| SMILES | CCCNC(CCC(F)(F)F)CSC(C)(C)C |
| InChI | InChI=1S/C12H24F3NS/c1-5-8-16-10(6-7-12(13,14)15)9-17-11(2,3)4/h10,16H,5-9H2,1-4H3 |
| InChIKey | PLFHGLIXXMJAEO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine?
The IUPAC name of 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine (CID 65132245) is 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine.
What is the SMILES notation for 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine?
The canonical SMILES for 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine is CCCNC(CCC(F)(F)F)CSC(C)(C)C.
What is the InChIKey of 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine?
The InChIKey is PLFHGLIXXMJAEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24F3NS/c1-5-8-16-10(6-7-12(13,14)15)9-17-11(2,3)4/h10,16H,5-9H2,1-4H3.
What are the key properties of 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine?
1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine has a molecular weight of 271.39 g/mol, XLogP of 4.23, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfanyl-5,5,5-trifluoro-N-propylpentan-2-amine is sourced from PubChem (CID 65132245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).