C13H14Cl2OS — CID 65138850
2-cyclopentylsulfanyl-1-(2,3-dichlorophenyl)ethanone (PubChem CID 65138850) has the molecular formula C13H14Cl2OS and a molecular weight of 289.23 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-1-(2,3-dichlorophenyl)ethanone.
| Compound Name | 2-cyclopentylsulfanyl-1-(2,3-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 65138850 |
| Molecular Formula | C13H14Cl2OS |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2-cyclopentylsulfanyl-1-(2,3-dichlorophenyl)ethanone |
| SMILES | O=C(CSC1CCCC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl2OS/c14-11-7-3-6-10(13(11)15)12(16)8-17-9-4-1-2-5-9/h3,6-7,9H,1-2,4-5,8H2 |
| InChIKey | RZIXHLGTUJETBP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |