C15H15ClO2S — CID 114725382
1-(7-chloro-1-benzofuran-2-yl)-2-cyclopentylsulfanylethanone (PubChem CID 114725382) has the molecular formula C15H15ClO2S and a molecular weight of 294.80 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-2-cyclopentylsulfanylethanone.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-2-cyclopentylsulfanylethanone |
|---|---|
| PubChem CID | 114725382 |
| Molecular Formula | C15H15ClO2S |
| Molecular Weight | 294.80 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-2-cyclopentylsulfanylethanone |
| SMILES | O=C(CSC1CCCC1)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C15H15ClO2S/c16-12-7-3-4-10-8-14(18-15(10)12)13(17)9-19-11-5-1-2-6-11/h3-4,7-8,11H,1-2,5-6,9H2 |
| InChIKey | SJTVOFCCIXWPJW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.80 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |