C18H17ClO2 — CID 65158245
2-[1-chloro-2-(oxolan-2-yl)ethyl]dibenzofuran (PubChem CID 65158245) has the molecular formula C18H17ClO2 and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-[1-chloro-2-(oxolan-2-yl)ethyl]dibenzofuran.
| Compound Name | 2-[1-chloro-2-(oxolan-2-yl)ethyl]dibenzofuran |
|---|---|
| PubChem CID | 65158245 |
| Molecular Formula | C18H17ClO2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[1-chloro-2-(oxolan-2-yl)ethyl]dibenzofuran |
| SMILES | ClC(CC1CCCO1)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C18H17ClO2/c19-16(11-13-4-3-9-20-13)12-7-8-18-15(10-12)14-5-1-2-6-17(14)21-18/h1-2,5-8,10,13,16H,3-4,9,11H2 |
| InChIKey | RLGQHGKGTZVGTA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|