C25H19NO5 — CID 1280562
20-[[(2S)-oxolan-2-yl]methyl]-2,15-dioxa-20-azapentacyclo[14.7.0.03,8.09,14.018,22]tricosa-1(16),3,5,7,9,11,13,17,22-nonaene-19,21-dione (PubChem CID 1280562) has the molecular formula C25H19NO5 and a molecular weight of 413.43 g/mol. Its IUPAC name is 20-[[(2S)-oxolan-2-yl]methyl]-2,15-dioxa-20-azapentacyclo[14.7.0.03,8.09,14.018,22]tricosa-1(16),3,5,7,9,11,13,17,22-nonaene-19,21-dione.
| Compound Name | 20-[[(2S)-oxolan-2-yl]methyl]-2,15-dioxa-20-azapentacyclo[14.7.0.03,8.09,14.018,22]tricosa-1(16),3,5,7,9,11,13,17,22-nonaene-19,21-dione |
|---|---|
| PubChem CID | 1280562 |
| Molecular Formula | C25H19NO5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 20-[[(2S)-oxolan-2-yl]methyl]-2,15-dioxa-20-azapentacyclo[14.7.0.03,8.09,14.018,22]tricosa-1(16),3,5,7,9,11,13,17,22-nonaene-19,21-dione |
| SMILES | O=C1c2cc3oc4ccccc4c4ccccc4oc3cc2C(=O)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C25H19NO5/c27-24-18-12-22-23(13-19(18)25(28)26(24)14-15-6-5-11-29-15)31-21-10-4-2-8-17(21)16-7-1-3-9-20(16)30-22/h1-4,7-10,12-13,15H,5-6,11,14H2/t15-/m0/s1 |
| InChIKey | IKAARFUSQNQQCZ-HNNXBMFYSA-N |
| XLogP | 5.23 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|