C11H15F2NO3S — CID 65189953
4-amino-3-(3,5-difluorophenyl)-1-methylsulfonylbutan-2-ol (PubChem CID 65189953) has the molecular formula C11H15F2NO3S and a molecular weight of 279.31 g/mol. Its IUPAC name is 4-amino-3-(3,5-difluorophenyl)-1-methylsulfonylbutan-2-ol.
| Compound Name | 4-amino-3-(3,5-difluorophenyl)-1-methylsulfonylbutan-2-ol |
|---|---|
| PubChem CID | 65189953 |
| Molecular Formula | C11H15F2NO3S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-amino-3-(3,5-difluorophenyl)-1-methylsulfonylbutan-2-ol |
| SMILES | CS(=O)(=O)CC(O)C(CN)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H15F2NO3S/c1-18(16,17)6-11(15)10(5-14)7-2-8(12)4-9(13)3-7/h2-4,10-11,15H,5-6,14H2,1H3 |
| InChIKey | ICHCGTVUUWTTQM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |