C11H16N2O3 — CID 65197098
1-(1,3-dimethylpyrazol-4-yl)-5-methoxypentane-1,3-dione (PubChem CID 65197098) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-5-methoxypentane-1,3-dione.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-5-methoxypentane-1,3-dione |
|---|---|
| PubChem CID | 65197098 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-5-methoxypentane-1,3-dione |
| SMILES | COCCC(=O)CC(=O)c1cn(C)nc1C |
| InChI | InChI=1S/C11H16N2O3/c1-8-10(7-13(2)12-8)11(15)6-9(14)4-5-16-3/h7H,4-6H2,1-3H3 |
| InChIKey | ZGVJTHYJCVJLSK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|