C21H19F2N3O3 — CID 6520263
(E)-2-(1H-benzimidazol-2-yl)-3-[4-(difluoromethoxy)phenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 6520263) has the molecular formula C21H19F2N3O3 and a molecular weight of 399.40 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[4-(difluoromethoxy)phenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[4-(difluoromethoxy)phenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 6520263 |
| Molecular Formula | C21H19F2N3O3 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[4-(difluoromethoxy)phenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccc(OC(F)F)cc1)c1nc2ccccc2[nH]1)N1CCOCC1 |
| InChI | InChI=1S/C21H19F2N3O3/c22-21(23)29-15-7-5-14(6-8-15)13-16(20(27)26-9-11-28-12-10-26)19-24-17-3-1-2-4-18(17)25-19/h1-8,13,21H,9-12H2,(H,24,25)/b16-13+ |
| InChIKey | ILPTXGVEILHPMI-DTQAZKPQSA-N |
| XLogP | 3.56 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|