C12H13BrN4OS — CID 65206995
N-(4-amino-2-bromophenyl)-4-propan-2-ylthiadiazole-5-carboxamide (PubChem CID 65206995) has the molecular formula C12H13BrN4OS and a molecular weight of 341.23 g/mol. Its IUPAC name is N-(4-amino-2-bromophenyl)-4-propan-2-ylthiadiazole-5-carboxamide.
| Compound Name | N-(4-amino-2-bromophenyl)-4-propan-2-ylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65206995 |
| Molecular Formula | C12H13BrN4OS |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | N-(4-amino-2-bromophenyl)-4-propan-2-ylthiadiazole-5-carboxamide |
| SMILES | CC(C)c1nnsc1C(=O)Nc1ccc(N)cc1Br |
| InChI | InChI=1S/C12H13BrN4OS/c1-6(2)10-11(19-17-16-10)12(18)15-9-4-3-7(14)5-8(9)13/h3-6H,14H2,1-2H3,(H,15,18) |
| InChIKey | KSTGXROSMOYURS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|