C13H14Cl2FN3S — CID 65209242
N-[[4-(2,4-dichloro-5-fluorophenyl)thiadiazol-5-yl]methyl]-2-methylpropan-2-amine (PubChem CID 65209242) has the molecular formula C13H14Cl2FN3S and a molecular weight of 334.25 g/mol. Its IUPAC name is N-[[4-(2,4-dichloro-5-fluorophenyl)thiadiazol-5-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[4-(2,4-dichloro-5-fluorophenyl)thiadiazol-5-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 65209242 |
| Molecular Formula | C13H14Cl2FN3S |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-[[4-(2,4-dichloro-5-fluorophenyl)thiadiazol-5-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1snnc1-c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2FN3S/c1-13(2,3)17-6-11-12(18-19-20-11)7-4-10(16)9(15)5-8(7)14/h4-5,17H,6H2,1-3H3 |
| InChIKey | CASMVWWCICMCGY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|