C11H10ClN3O3S2 — CID 65214562
4-[1-(thiadiazole-4-carbonylamino)ethyl]benzenesulfonyl chloride (PubChem CID 65214562) has the molecular formula C11H10ClN3O3S2 and a molecular weight of 331.81 g/mol. Its IUPAC name is 4-[1-(thiadiazole-4-carbonylamino)ethyl]benzenesulfonyl chloride.
| Compound Name | 4-[1-(thiadiazole-4-carbonylamino)ethyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65214562 |
| Molecular Formula | C11H10ClN3O3S2 |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 4-[1-(thiadiazole-4-carbonylamino)ethyl]benzenesulfonyl chloride |
| SMILES | CC(NC(=O)c1csnn1)c1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C11H10ClN3O3S2/c1-7(13-11(16)10-6-19-15-14-10)8-2-4-9(5-3-8)20(12,17)18/h2-7H,1H3,(H,13,16) |
| InChIKey | NFWXOQHYLZYRFL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |