C16H22ClFN2O — CID 65230216
2-(aminomethyl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpentanamide (PubChem CID 65230216) has the molecular formula C16H22ClFN2O and a molecular weight of 312.82 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpentanamide.
| Compound Name | 2-(aminomethyl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpentanamide |
|---|---|
| PubChem CID | 65230216 |
| Molecular Formula | C16H22ClFN2O |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-(aminomethyl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpentanamide |
| SMILES | CCCC(CN)C(=O)N(Cc1c(F)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C16H22ClFN2O/c1-2-4-11(9-19)16(21)20(12-7-8-12)10-13-14(17)5-3-6-15(13)18/h3,5-6,11-12H,2,4,7-10,19H2,1H3 |
| InChIKey | AKUVXNPTIREBJR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |