3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid

C15H29NO2 — CID 65264467

IUPAC3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid
SMILESCC1CCC(NC(C)(C)C(C)(C)C(=O)O)CC1C
InChIInChI=1S/C15H29NO2/c1-10-7-8-12(9-11(10)2)16-15(5,6)14(3,4)13(17)18/h10-12,16H,7-9H2,1-6H3,(H,17,18)
InChIKeyJLOXBFWDWAKPON-UHFFFAOYSA-N
MW255.40 g/mol
LogP3.29
Rot. Bonds4

About 3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid

3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid (PubChem CID 65264467) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid.

Molecular Properties

Compound Name3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid
PubChem CID65264467
Molecular FormulaC15H29NO2
Molecular Weight255.40 g/mol
Exact Mass255.22
IUPAC Name3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid
SMILESCC1CCC(NC(C)(C)C(C)(C)C(=O)O)CC1C
InChIInChI=1S/C15H29NO2/c1-10-7-8-12(9-11(10)2)16-15(5,6)14(3,4)13(17)18/h10-12,16H,7-9H2,1-6H3,(H,17,18)
InChIKeyJLOXBFWDWAKPON-UHFFFAOYSA-N
XLogP3.29
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.40
LogP ≤ 53.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid?
The IUPAC name of 3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid (CID 65264467) is 3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid.
What is the SMILES notation for 3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid?
The canonical SMILES for 3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid is CC1CCC(NC(C)(C)C(C)(C)C(=O)O)CC1C.
What is the InChIKey of 3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid?
The InChIKey is JLOXBFWDWAKPON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-10-7-8-12(9-11(10)2)16-15(5,6)14(3,4)13(17)18/h10-12,16H,7-9H2,1-6H3,(H,17,18).
What are the key properties of 3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid?
3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid has a molecular weight of 255.40 g/mol, XLogP of 3.29, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dimethylcyclohexyl)amino]-2,2,3-trimethylbutanoic acid is sourced from PubChem (CID 65264467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).