About 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole
5-pyrrolidin-3-yloxy-1,2,4-thiadiazole (PubChem CID 65275097) has the molecular formula C6H9N3OS
and a molecular weight of 171.22 g/mol. Its IUPAC name is 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole |
| PubChem CID | 65275097 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole |
| SMILES | c1nsc(OC2CCNC2)n1 |
| InChI | InChI=1S/C6H9N3OS/c1-2-7-3-5(1)10-6-8-4-9-11-6/h4-5,7H,1-3H2 |
| InChIKey | HFTVEBMEFFWFEI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole?
The IUPAC name of 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole (CID 65275097) is 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole.
What is the SMILES notation for 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole?
The canonical SMILES for 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole is c1nsc(OC2CCNC2)n1.
What is the InChIKey of 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole?
The InChIKey is HFTVEBMEFFWFEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3OS/c1-2-7-3-5(1)10-6-8-4-9-11-6/h4-5,7H,1-3H2.
What are the key properties of 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole?
5-pyrrolidin-3-yloxy-1,2,4-thiadiazole has a molecular weight of 171.22 g/mol, XLogP of 0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrolidin-3-yloxy-1,2,4-thiadiazole is sourced from PubChem (CID 65275097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).