About 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine
3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65276194) has the molecular formula C12H21N5S
and a molecular weight of 267.40 g/mol. Its IUPAC name is 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 65276194 |
| Molecular Formula | C12H21N5S |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine |
| SMILES | C(CNc1nc(C2CC2)ns1)CN1CCNCC1 |
| InChI | InChI=1S/C12H21N5S/c1(7-17-8-5-13-6-9-17)4-14-12-15-11(16-18-12)10-2-3-10/h10,13H,1-9H2,(H,14,15,16) |
| InChIKey | OKPLRTRGCHCBQY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine (CID 65276194) is 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine is C(CNc1nc(C2CC2)ns1)CN1CCNCC1.
What is the InChIKey of 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine?
The InChIKey is OKPLRTRGCHCBQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5S/c1(7-17-8-5-13-6-9-17)4-14-12-15-11(16-18-12)10-2-3-10/h10,13H,1-9H2,(H,14,15,16).
What are the key properties of 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine?
3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine has a molecular weight of 267.40 g/mol, XLogP of 1.12, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 65276194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).