C12H21N5S — CID 65276194
3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65276194) has the molecular formula C12H21N5S and a molecular weight of 267.40 g/mol. Its IUPAC name is 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65276194 |
| Molecular Formula | C12H21N5S |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1,2,4-thiadiazol-5-amine |
| SMILES | C(CNc1nc(C2CC2)ns1)CN1CCNCC1 |
| InChI | InChI=1S/C12H21N5S/c1(7-17-8-5-13-6-9-17)4-14-12-15-11(16-18-12)10-2-3-10/h10,13H,1-9H2,(H,14,15,16) |
| InChIKey | OKPLRTRGCHCBQY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|